5-chloro Hydrochlorothiazide is a derivative of hydrochlorothiazide, which is a diuretic and antihypertensive agent that increases renal excretion of sodium, potassium, chloride, and bicarbonate ions by inhibiting tubular reabsorptive mechanisms.
Catalog Number | R011397 |
CAS Number | 5233-42-1 |
Synonyms | 5,6-Dichloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-Dioxide; |
Molecular Formula | C7H7Cl2N3O4S2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 5,6-dichloro-1,1-dioxo-3,4-dihydro-2H-1$l^{6} |
InChI | InChI=1S/C7H7Cl2N3O4S2/c8-5-3(17(10,13)14)1-4-7(6(5)9)11-2-12-18(4,15)16/h1,11-12H,2H2,(H2,10,13,14) |
InChIKey | BSNKBIJVLZUERH-UHFFFAOYSA-N |
SMILES | C1NC2=C(C(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl)Cl |