For research use only. Not for therapeutic Use.
5-Chloro-6-methylpyrazine-2-carboxylic acid is a high-purity chemical compound used in pharmaceutical and chemical research. This pyrazine derivative, featuring a chlorine atom at the 5-position and a methyl group at the 6-position, is valuable in the synthesis of various bioactive molecules. Its unique structure makes it useful in the development of agrochemicals and pharmaceuticals, especially in studies related to enzyme inhibition and molecular interactions. The compound’s stability and reactivity offer versatile applications in synthetic chemistry and medicinal research.
| CAS Number | 188781-36-4 |
| Molecular Formula | C6H5ClN2O2 |
| Purity | ≥95% |
| IUPAC Name | 5-chloro-6-methylpyrazine-2-carboxylic acid |
| InChI | InChI=1S/C6H5ClN2O2/c1-3-5(7)8-2-4(9-3)6(10)11/h2H,1H3,(H,10,11) |
| InChIKey | GWONLNJXMKSZGV-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CN=C1Cl)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |