For research use only. Not for therapeutic Use.
5-Chloro-6-methyl-1H-pyrrolo[2,3-b]pyridine(Cat No.:L039811)is a chlorinated heteroaromatic compound featuring a fused pyrrole–pyridine ring system with a chlorine atom at the 5-position and a methyl group at the 6-position. This scaffold is commonly used in medicinal chemistry for designing kinase inhibitors, anti-inflammatory agents, and CNS-active drugs due to its resemblance to purine and indole systems. The chlorine atom enables further functionalization via cross-coupling reactions, while the methyl group fine-tunes the molecule’s electronic and steric properties. Its rigid, planar structure supports strong receptor binding and high biological relevance in drug discovery applications.
CAS Number | 1000340-18-0 |
Molecular Formula | C8H7ClN2 |
Purity | ≥95% |
IUPAC Name | 5-chloro-6-methyl-1H-pyrrolo[2,3-b]pyridine |
InChI | InChI=1S/C8H7ClN2/c1-5-7(9)4-6-2-3-10-8(6)11-5/h2-4H,1H3,(H,10,11) |
InChIKey | KPLGQZRPWPKTCV-UHFFFAOYSA-N |
SMILES | CC1=C(C=C2C=CNC2=N1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |