5-Chloro-2-methyl-3-isothiazolone(CAT: R046035) is a biocidal compound commonly used as a preservative in various industrial applications, including paints, coatings, and personal care products. It belongs to the isothiazolinone family, known for its antimicrobial properties, effectively controlling bacterial and fungal growth. Due to its potent biocidal activity, it is often formulated with other preservatives to enhance efficacy in product preservation. However, it can cause skin sensitization and allergic reactions in some individuals, which has led to regulatory restrictions on its use in certain consumer products. Its effectiveness in controlling microbial contamination makes it a valuable preservative in many industries.
| Catalog Number | R046035 |
| CAS Number | 26172-55-4 |
| Synonyms | 5-Chloro-2-methyl-3(2H)-isothiazolone; 2-Methyl-5-chloro-3-isothiazolone; 2-Methyl-5-chloroisothiazolin-3-one; A 33; Bioace; HS 818; Kathon CG 5243; Kathon IXE; Methylchloroisothiazolinone; |
| Molecular Formula | C4H4ClNOS |
| Purity | ≥95% |
| Storage | -20°C |
| Related CAS | 137086-87-4 |
| IUPAC Name | 5-chloro-2-methyl-1,2-thiazol-3-one |
| InChI | InChI=1S/C4H4ClNOS/c1-6-4(7)2-3(5)8-6/h2H,1H3 |
| InChIKey | DHNRXBZYEKSXIM-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=C(S1)Cl |
