For research use only. Not for therapeutic Use.
5-Chloro-2-methoxy-3-nitrobenzoic acid(Cat No.:L007470), is a chemical compound featuring a benzene ring with chloro (-Cl), methoxy (-OCH3), and nitro (-NO2) functional groups attached at specific positions. This specific arrangement of atoms grants the compound unique chemical properties, making it valuable in various research and industrial applications. Scientists often use it as a building block in the synthesis of more complex organic compounds due to its reactivity and ability to participate in various chemical reactions.
CAS Number | 89894-14-4 |
Molecular Formula | C8H6ClNO5 |
Purity | ≥95% |
IUPAC Name | 5-chloro-2-methoxy-3-nitrobenzoic acid |
InChI | InChI=1S/C8H6ClNO5/c1-15-7-5(8(11)12)2-4(9)3-6(7)10(13)14/h2-3H,1H3,(H,11,12) |
InChIKey | BNPVOSZKWOIXHK-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1[N+](=O)[O-])Cl)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |