For research use only. Not for therapeutic Use.
5-Chloro-2-hydrazinylpyridine(Cat No.:L021939)is a heterocyclic aromatic compound with the molecular formula C5H6ClN3. It features a pyridine ring substituted with a chlorine atom at the 5-position and a hydrazinyl group (–NHNH₂) at the 2-position. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and heterocyclic compounds due to its bifunctional reactivity—offering both nucleophilic and electrophilic sites. The hydrazinyl group facilitates the formation of hydrazones, diazoles, and other nitrogen-containing scaffolds. It is typically a crystalline solid, requiring careful handling due to potential sensitivity and toxicity. Store in a cool, dry place.
| CAS Number | 27032-63-9 |
| Molecular Formula | C5H6ClN3 |
| Purity | ≥95% |
| IUPAC Name | (5-chloropyridin-2-yl)hydrazine |
| InChI | InChI=1S/C5H6ClN3/c6-4-1-2-5(9-7)8-3-4/h1-3H,7H2,(H,8,9) |
| InChIKey | UXJYFOOFLZGBEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)NN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |