For research use only. Not for therapeutic Use.
5-Chloro-2-fluoropyridine (Cat.No:M049313) is a chemical compound used as a versatile building block in the synthesis of pharmaceuticals and agrochemicals. Its unique structure, combining chlorine and fluorine atoms on a pyridine ring, provides a valuable starting point for creating complex organic molecules with diverse applications in the field of chemistry and materials science.
CAS Number | 1480-65-5 |
Molecular Formula | C5H3ClFN |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-chloro-2-fluoropyridine |
InChI | InChI=1S/C5H3ClFN/c6-4-1-2-5(7)8-3-4/h1-3H |
InChIKey | ZULRQGBHWBQPFE-UHFFFAOYSA-N |
SMILES | C1=CC(=NC=C1Cl)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |