For research use only. Not for therapeutic Use.
5-Bromovaleryl chloride(Cat No.:L007128), is a chemical compound. It consists of a valeryl group (a five-carbon straight-chain alkyl group) with a bromine atom at the 5th position, and a chloride (Cl) group attached to the valeryl carbon. This compound is utilized in organic synthesis as a versatile intermediate, particularly in the preparation of pharmaceuticals, agrochemicals, and other specialty chemicals. Its reactivity allows it to participate in various chemical transformations, enabling the creation of diverse molecules used in research and industrial applications, contributing significantly to the field of organic chemistry.
| CAS Number | 4509-90-4 |
| Molecular Formula | C5H8BrClO |
| Purity | ≥95% |
| IUPAC Name | 5-bromopentanoyl chloride |
| InChI | InChI=1S/C5H8BrClO/c6-4-2-1-3-5(7)8/h1-4H2 |
| InChIKey | OKRUMSWHDWKGHA-UHFFFAOYSA-N |
| SMILES | C(CCBr)CC(=O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |