For research use only. Not for therapeutic Use.
5-Bromothiophene-2-sulfonyl fluoride(Cat No.:L007667), is a chemical compound characterized by a thiophene ring substituted with a bromine atom at the 5-position and a sulfonyl fluoride group at the 2-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers use it as a versatile reagent in various chemical transformations, especially in the creation of specialized organic molecules.
CAS Number | 108158-00-5 |
Molecular Formula | C4H2BrFO2S2 |
Purity | ≥95% |
IUPAC Name | 5-bromothiophene-2-sulfonyl fluoride |
InChI | InChI=1S/C4H2BrFO2S2/c5-3-1-2-4(9-3)10(6,7)8/h1-2H |
InChIKey | YZLKSNCDWSSCNL-UHFFFAOYSA-N |
SMILES | C1=C(SC(=C1)Br)S(=O)(=O)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |