For research use only. Not for therapeutic Use.
(5-Bromopyridin-3-yl)methanol(CAT: L030108) is a versatile compound widely used in organic synthesis and pharmaceutical research. Featuring a bromine-substituted pyridine ring with a methanol group, it serves as a key building block in the synthesis of more complex molecules, including heterocyclic compounds and active pharmaceutical ingredients. Its structure allows for various functionalization opportunities, making it valuable in developing inhibitors, ligands, and probes for biological studies. Researchers often utilize (5-Bromopyridin-3-yl)methanol in the fields of medicinal chemistry and drug discovery to create novel compounds for therapeutic applications and to investigate molecular interactions within biological systems.
CAS Number | 37669-64-0 |
Molecular Formula | C6H6BrNO |
Purity | ≥95% |
IUPAC Name | (5-bromopyridin-3-yl)methanol |
InChI | InChI=1S/C6H6BrNO/c7-6-1-5(4-9)2-8-3-6/h1-3,9H,4H2 |
InChIKey | WDVDHJLKXYCOFS-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |