For research use only. Not for therapeutic Use.
5-Bromoisophthaloyl dichloride is an aromatic compound characterized by a bromine atom at the fifth position of the isophthaloyl moiety. This compound features two reactive chloride groups, making it a versatile intermediate in organic synthesis. It is often used in the production of polyesters, polyamides, and other polymers due to its ability to form covalent bonds with various nucleophiles. Additionally, its unique structure may impart specific properties, making it valuable in materials science and pharmaceutical applications.
| CAS Number | 57863-69-1 |
| Molecular Formula | C8H3BrCl2O2 |
| Purity | ≥95% |
| IUPAC Name | 5-bromobenzene-1,3-dicarbonyl chloride |
| InChI | InChI=1S/C8H3BrCl2O2/c9-6-2-4(7(10)12)1-5(3-6)8(11)13/h1-3H |
| InChIKey | MMGMYZMTUVIVSU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)Cl)Br)C(=O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |