For research use only. Not for therapeutic Use.
5-Bromo-4,6-difluoropyrimidine(Cat No.:L007130), is a chemical compound with the molecular formula C4HBrF2N2. It is a pyrimidine derivative substituted with bromine at the 5th position and fluorine atoms at the 4th and 6th positions. This compound is valuable in pharmaceutical and agrochemical research, serving as a key intermediate in the synthesis of various biologically active compounds. Its unique structure enables it to participate in diverse chemical transformations, making it a crucial building block for the development of specialized pharmaceuticals and agrochemicals, contributing significantly to advancements in drug discovery and crop protection technologies within the chemical industry.
CAS Number | 946681-88-5 |
Molecular Formula | C4HBrF2N2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 5-bromo-4,6-difluoropyrimidine |
InChI | InChI=1S/C4HBrF2N2/c5-2-3(6)8-1-9-4(2)7/h1H |
InChIKey | XIBSHDQUWTUSAI-UHFFFAOYSA-N |
SMILES | C1=NC(=C(C(=N1)F)Br)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |