For research use only. Not for therapeutic Use.
5-Bromo-4-hydroxypicolinonitrile(Cat No.:L003066)is a high-purity heterocyclic compound commonly used in pharmaceutical and chemical research. Featuring a bromine atom and a hydroxyl group on a picolinonitrile core, this compound serves as a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates and agrochemicals. Its unique structure allows for selective reactivity and diverse chemical transformations, making it a valuable building block in medicinal chemistry. 5-Bromo-4-hydroxypicolinonitrile is ideal for precision synthetic applications, supporting innovative research and development in the field.
CAS Number | 1369850-06-5 |
Molecular Formula | C6H3BrN2O |
Purity | ≥95% |
IUPAC Name | 5-bromo-4-oxo-1H-pyridine-2-carbonitrile |
InChI | InChI=1S/C6H3BrN2O/c7-5-3-9-4(2-8)1-6(5)10/h1,3H,(H,9,10) |
InChIKey | QXCKFHGGWOUCAE-UHFFFAOYSA-N |
SMILES | C1=C(NC=C(C1=O)Br)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |