For research use only. Not for therapeutic Use.
5-Bromo-4-hydroxynicotinaldehyde is an organic compound derived from nicotinic acid, featuring a bromine substituent at the 5-position and a hydroxyl group at the 4-position, along with an aldehyde functional group. This unique structure enhances its reactivity and potential biological activity. The hydroxyl group can participate in hydrogen bonding, while the bromine atom adds to its electrophilic nature, making it valuable in organic synthesis. This compound may serve as a precursor in the development of pharmaceuticals or agrochemicals with specific therapeutic targets.
CAS Number | 1289109-05-2 |
Molecular Formula | C6H4BrNO2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-4-oxo-1H-pyridine-3-carbaldehyde |
InChI | InChI=1S/C6H4BrNO2/c7-5-2-8-1-4(3-9)6(5)10/h1-3H,(H,8,10) |
InChIKey | KPMMFNJPSDBZTB-UHFFFAOYSA-N |
SMILES | C1=C(C(=O)C(=CN1)Br)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |