For research use only. Not for therapeutic Use.
5-Bromo-3-chloro-2-methylbenzoic acid(Cat No.:L007828), is a chemically significant compound widely utilized in various fields, including medicinal chemistry and material science. Its molecular structure consists of a benzene ring substituted with bromine, chlorine, and a methyl group. This compound serves as a crucial building block in the synthesis of complex organic molecules, pharmaceuticals, and advanced materials. Researchers often employ it as a starting material for the creation of novel chemical entities, enabling the development of new drugs and materials with diverse applications.
| CAS Number | 1540188-38-2 |
| Molecular Formula | C8H6BrClO2 |
| Purity | ≥95% |
| IUPAC Name | 5-bromo-3-chloro-2-methylbenzoic acid |
| InChI | InChI=1S/C8H6BrClO2/c1-4-6(8(11)12)2-5(9)3-7(4)10/h2-3H,1H3,(H,11,12) |
| InChIKey | FMMKWJSZMUYJAR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)Br)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |