For research use only. Not for therapeutic Use.
5-Bromo-2,3-dihydro-1H-inden-1-ol is a brominated indene derivative featuring a hydroxyl group at the 1-position. This compound is notable for its potential applications in organic synthesis and medicinal chemistry, particularly for its biological activities, including anti-inflammatory and anticancer effects. The presence of the bromine atom enhances its reactivity, allowing for diverse chemical transformations. Its unique structure makes it a valuable intermediate for the development of novel therapeutic agents and in exploring new applications in drug discovery and material science.
CAS Number | 34598-50-0 |
Molecular Formula | C9H9BrO |
Purity | ≥95% |
IUPAC Name | 5-bromo-2,3-dihydro-1H-inden-1-ol |
InChI | InChI=1S/C9H9BrO/c10-7-2-3-8-6(5-7)1-4-9(8)11/h2-3,5,9,11H,1,4H2 |
InChIKey | DRXIUUZVRAOHBS-UHFFFAOYSA-N |
SMILES | C1CC2=C(C1O)C=CC(=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |