For research use only. Not for therapeutic Use.
5-Bromo-2,2-difluoro-1,3-benzodioxole(Cat No.:L023487)is a halogenated aromatic compound featuring a benzodioxole ring with geminal difluoro substitution at the 2-position and a bromine atom at the 5-position. Its rigid, electron-rich core and halogen functionalities make it highly useful in pharmaceutical, agrochemical, and material science applications. The bromine atom allows for further functionalization via cross-coupling reactions such as Suzuki or Heck coupling, while the difluoro group enhances metabolic stability and lipophilicity. This compound is often employed as a building block for synthesizing bioactive molecules and fluorinated heterocyclic frameworks.
| CAS Number | 33070-32-5 |
| Molecular Formula | C7H3BrF2O2 |
| Purity | ≥95% |
| IUPAC Name | 5-bromo-2,2-difluoro-1,3-benzodioxole |
| InChI | InChI=1S/C7H3BrF2O2/c8-4-1-2-5-6(3-4)12-7(9,10)11-5/h1-3H |
| InChIKey | SZRHWHHXVXSGMT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC(O2)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |