For research use only. Not for therapeutic Use.
5-Bromo-2-(methylsulfinyl)pyrimidine(Cat No.:L033650)is a brominated pyrimidine derivative featuring a methylsulfinyl group, enhancing its chemical reactivity and utility in organic synthesis. This compound is critical in pharmaceutical research, particularly for developing kinase inhibitors and other drug molecules targeting cellular signaling pathways. Its bromo group facilitates cross-coupling reactions, while the methylsulfinyl group increases polarity and improves metabolic stability. 5-Bromo-2-(methylsulfinyl)pyrimidine serves as a versatile building block in medicinal chemistry, contributing to the synthesis of compounds with potential therapeutic benefits in cancer treatment and other diseases.
CAS Number | 79685-17-9 |
Molecular Formula | C5H5BrN2OS |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-methylsulfinylpyrimidine |
InChI | InChI=1S/C5H5BrN2OS/c1-10(9)5-7-2-4(6)3-8-5/h2-3H,1H3 |
InChIKey | WYOCZUNSYMRRKF-UHFFFAOYSA-N |
SMILES | CS(=O)C1=NC=C(C=N1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |