Home
>
Chemical Reagents>Heterocyclic Building Blocks> 5-bromo-2-methyl-3,4-dihydroisoquinolin-1(2H)-one
For research use only. Not for therapeutic Use.
5-Bromo-2-methyl-3,4-dihydroisoquinolin-1(2H)-one(CAT: L048765) is a brominated isoquinolinone derivative featuring a saturated 3,4-dihydro ring and a methyl group at the 2-position. The bromine substituent at the 5-position enables halogen-based functionalization, such as cross-coupling reactions (e.g., Suzuki, Heck), making it a valuable intermediate in medicinal chemistry and heterocyclic compound synthesis. Its rigid isoquinolinone core supports applications in CNS drug development, kinase inhibitor design, and analogs of bioactive natural products. The compound’s balanced reactivity and aromatic-nitrogen framework make it suitable for use in lead optimization, SAR studies, and the synthesis of complex pharmacophores in advanced pharmaceutical research.
| CAS Number | 1100509-38-3 |
| Molecular Formula | C10H10BrNO |
| Purity | ≥95% |
| IUPAC Name | 5-bromo-2-methyl-3,4-dihydroisoquinolin-1-one |
| InChI | InChI=1S/C10H10BrNO/c1-12-6-5-7-8(10(12)13)3-2-4-9(7)11/h2-4H,5-6H2,1H3 |
| InChIKey | AJKRPJAQUJYKER-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |