For research use only. Not for therapeutic Use.
5-Bromo-2-(bromomethyl)pyridine hydrobromide(Cat No.:M140618) is a chemical compound with the molecular formula C6H6Br3N. It is a brominated derivative of pyridine, containing both a bromine atom at the 5-position and a bromomethyl group attached to the 2-position of the pyridine ring. This compound is commonly used as a building block in organic synthesis, particularly in the pharmaceutical industry for preparing various biologically active compounds. The hydrobromide salt form of 5-bromo-2-(bromomethyl)pyridine enhances its solubility in polar solvents, making it easier to handle and use in chemical reactions.
CAS Number | 173999-22-9 |
Synonyms | 5-bromo-2-(bromomethyl)pyridine hydrobromide |
Molecular Formula | C6H6Br3N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-bromo-2-(bromomethyl)pyridine;hydrobromide |
InChI | InChI=1S/C6H5Br2N.BrH/c7-3-6-2-1-5(8)4-9-6;/h1-2,4H,3H2;1H |
InChIKey | FXNFAIHZLXLWBR-UHFFFAOYSA-N |
SMILES | C1=CC(=NC=C1Br)CBr.Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |