Home
>
Chemical Reagents>Organic Building Blocks> 5-Bromo-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine
For research use only. Not for therapeutic Use.
5-Bromo-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine(Cat No.:L028438)is a heteroaromatic compound featuring a pyrrolo[2,3-b]pyridine core, a bromine atom at the 5-position, and a triisopropylsilyl (TIPS) protecting group on the nitrogen at the 1-position. The TIPS group provides steric protection and enhances compound stability during multi-step synthesis, while the bromine substituent enables palladium-catalyzed cross-coupling reactions such as Suzuki, Sonogashira, or Buchwald–Hartwig. This compound is widely used as a synthetic intermediate in medicinal chemistry and materials science, particularly for the construction of complex heterocyclic systems and development of bioactive molecules or electronic materials.
CAS Number | 858116-66-2 |
Molecular Formula | C16H25BrN2Si |
Purity | ≥95% |
IUPAC Name | (5-bromopyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
InChI | InChI=1S/C16H25BrN2Si/c1-11(2)20(12(3)4,13(5)6)19-8-7-14-9-15(17)10-18-16(14)19/h7-13H,1-6H3 |
InChIKey | UJUSITKTVXDVLQ-UHFFFAOYSA-N |
SMILES | CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=CC(=CN=C21)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |