5-Bromo-1-chloro-8-methoxyisoquinoline(CAT: L000508) is a chemical compound of interest in organic and material chemistry. In organic chemistry, it can serve as a versatile building block for the synthesis of various organic molecules with potential applications in pharmaceuticals, agrochemicals, and other fields. Its unique structure and functional groups make it valuable for the design and development of compounds with specific properties.
Catalog Number | L000508 |
CAS Number | 1690846-94-6 |
Molecular Formula | C10H7BrClNO |
Purity | 95% |
IUPAC Name | 5-bromo-1-chloro-8-methoxyisoquinoline |
InChI | InChI=1S/C10H7BrClNO/c1-14-8-3-2-7(11)6-4-5-13-10(12)9(6)8/h2-5H,1H3 |
InChIKey | QEWJYCCAUNYCKY-UHFFFAOYSA-N |