For research use only. Not for therapeutic Use.
5-(Benzyloxy)pentan-2-ol(Cat No.:L007596), is a chemical compound characterized by a pentan-2-ol backbone with a benzyloxy group attached at the 5-position. This molecular structure combines an alcohol and an ether functional group, making it significant in organic synthesis and medicinal chemistry. Researchers utilize it as a building block for the creation of diverse organic molecules, especially in drug discovery. Its versatile reactivity and stability make it valuable for chemical transformations.
CAS Number | 194794-54-2 |
Molecular Formula | C12H18O2 |
Purity | ≥95% |
IUPAC Name | 5-phenylmethoxypentan-2-ol |
InChI | InChI=1S/C12H18O2/c1-11(13)6-5-9-14-10-12-7-3-2-4-8-12/h2-4,7-8,11,13H,5-6,9-10H2,1H3 |
InChIKey | MQAOYJYQYFYYIE-UHFFFAOYSA-N |
SMILES | CC(CCCOCC1=CC=CC=C1)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |