For research use only. Not for therapeutic Use.
5-Benzyloxyindole (Cat No.: R049088) is an organic compound with the molecular formula C15H13NO. It features an indole core—a bicyclic structure composed of a benzene ring fused to a pyrrole ring—with a benzyloxy group attached at the 5-position. This substitution enhances the molecule’s lipophilicity and reactivity, making it useful in pharmaceutical and chemical research. 5-Benzyloxyindole serves as an intermediate in the synthesis of biologically active compounds, including serotonin analogs, receptor ligands, and various heterocyclic drugs targeting neurological or oncological pathways.
| CAS Number | 1215-59-4 |
| Synonyms | 5-(Phenylmethoxy)-1H-indole; 5-(Benzyloxy)-1H-indole; 5-Benzyloxyindole; Benzyl 1H-Indol-5-yl Ether; NSC 62895; |
| Molecular Formula | C15H13NO |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | 5-phenylmethoxy-1H-indole |
| InChI | InChI=1S/C15H13NO/c1-2-4-12(5-3-1)11-17-14-6-7-15-13(10-14)8-9-16-15/h1-10,16H,11H2 |
| InChIKey | JCQLPDZCNSVBMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |