For research use only. Not for therapeutic Use.
5-Benzyloxygramine（Cat No.:M047303）is a synthetic indole derivative featuring a benzyloxy substitution at the 5-position of the gramine scaffold. Structurally related to serotonin analogs, it is primarily used as an intermediate in the synthesis of biologically active molecules and pharmacological probes. Its indole core enables interactions with a variety of biological targets, making it useful in medicinal chemistry and drug development. Although not widely characterized for direct biological activity, 5-Benzyloxygramine serves as a valuable building block in research involving indole-based compounds, receptor ligands, and neuroactive agents.
| CAS Number | 1453-97-0 |
| Synonyms | N,N-dimethyl-1-(5-phenylmethoxy-1H-indol-3-yl)methanamine |
| Molecular Formula | C18H20N2O |
| Purity | ≥95% |
| IUPAC Name | N,N-dimethyl-1-(5-phenylmethoxy-1H-indol-3-yl)methanamine |
| InChI | InChI=1S/C18H20N2O/c1-20(2)12-15-11-19-18-9-8-16(10-17(15)18)21-13-14-6-4-3-5-7-14/h3-11,19H,12-13H2,1-2H3 |
| InChIKey | POTVAILTNPOQJH-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CNC2=C1C=C(C=C2)OCC3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
