For research use only. Not for therapeutic Use.
5-Azauracil(CAT: R003267) is a chemical compound that finds application primarily in biochemical and research contexts. It is an analog of uracil and is known for its mode of action as an antimetabolite. Pharmacologically, 5-Azauracil interferes with the biosynthesis of nucleic acids, specifically RNA, by inhibiting the enzyme orotidine 5′-phosphate decarboxylase. This disruption of nucleotide synthesis makes it a valuable tool in studying nucleic acid metabolism and as a potential agent in chemotherapy research.
| CAS Number | 71-33-0 |
| Synonyms | s-Triazine-2,4-(1H,3H)-dione; Allantoxaidin; Allantoxaidine; NSC 56901; Oxaidin; |
| Molecular Formula | C3H3N3O2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 1H-1,3,5-triazine-2,4-dione |
| InChI | InChI=1S/C3H3N3O2/c7-2-4-1-5-3(8)6-2/h1H,(H2,4,5,6,7,8) |
| InChIKey | GEWRKGDRYZIFNP-UHFFFAOYSA-N |
| SMILES | C1=NC(=O)NC(=O)N1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |