For research use only. Not for therapeutic Use.
5-Aza cytosine (Cat No.: R003266), also known as 4-amino-1,2,3-triazin-2(1H)-one, is a synthetic analog of cytosine where a nitrogen atom replaces the carbon at the 5-position of the pyrimidine ring. It plays a key role in epigenetic research as a DNA methylation inhibitor, often used to study gene expression regulation. By incorporating into DNA, it interferes with DNA methyltransferase activity, leading to hypomethylation. 5-Aza cytosine is structurally related to 5-azacytidine and is used in anticancer and genetic studies.
CAS Number | 931-86-2 |
Synonyms | 4-Amino-s-triazin-2(1H)-one; 6-Amino-1,3,5-triazin-2(1H)-one; 4-Amino-s-triazin-2-ol; NSC 51100; NSC 54006; USP Azacitidine Related Compound A |
Molecular Formula | C3H4N4O |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 6-amino-1H-1,3,5-triazin-2-one |
InChI | InChI=1S/C3H4N4O/c4-2-5-1-6-3(8)7-2/h1H,(H3,4,5,6,7,8) |
InChIKey | MFEFTTYGMZOIKO-UHFFFAOYSA-N |
SMILES | C1=NC(=O)NC(=N1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |