For research use only. Not for therapeutic Use.
5-Aminovaleric acid (Cat No.:I019908) is a naturally occurring non-proteinogenic amino acid with the molecular formula C5H11NO2. It consists of a five-carbon chain with an amino group at one end and a carboxylic acid group at the other. This compound is structurally similar to gamma-aminobutyric acid (GABA) and can act as a metabolic intermediate in the degradation of lysine and other amino acids. 5-Aminovaleric acid is used in biochemical research and as a monomer in the development of biodegradable polyamides. It is water-soluble and generally stable under standard laboratory conditions.
| CAS Number | 660-88-8 |
| Synonyms | 5-aminopentanoic acid |
| Molecular Formula | C5H11NO2 |
| Purity | ≥95% |
| IUPAC Name | 5-aminopentanoic acid |
| InChI | InChI=1S/C5H11NO2/c6-4-2-1-3-5(7)8/h1-4,6H2,(H,7,8) |
| InChIKey | JJMDCOVWQOJGCB-UHFFFAOYSA-N |
| SMILES | C(CCN)CC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
