For research use only. Not for therapeutic Use.
5-Amino-4-cyano-1-methylpyrazole(Cat No.:R003338)is a nitrogen-rich heterocyclic compound featuring a pyrazole ring substituted with an amino group at position 5, a cyano group at position 4, and a methyl group at the N1 position. This multifunctional structure offers both nucleophilic (amino) and electrophilic (cyano) sites, making it highly versatile in organic synthesis. It serves as a valuable intermediate in the preparation of pharmaceuticals, agrochemicals, and energetic materials. The electron-withdrawing cyano group and electron-donating amino group contribute to its reactivity, supporting cyclization, substitution, and condensation reactions for constructing complex molecular frameworks.
| CAS Number | 5334-41-8 |
| Synonyms | 5-Amino-1-methyl-1H-pyrazole-4-carbonitrile; NSC 102022; NSC 1412; 5-Amino-1-methyl-1H-pyrazole-4-carbonitrile; 5-Amino-1-methyl-4-cyanopyrazole; |
| Molecular Formula | C5H6N4 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 5-amino-1-methylpyrazole-4-carbonitrile |
| InChI | InChI=1S/C5H6N4/c1-9-5(7)4(2-6)3-8-9/h3H,7H2,1H3 |
| InChIKey | MZFBWODPTSTYAI-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C#N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |