For research use only. Not for therapeutic Use.
5-Amino-2-nitrobenzoic acid (Cat No.: R005165) is an aromatic compound featuring both amino and nitro substituents on a benzoic acid ring. The amino group at the 5-position and the nitro group at the 2-position create a chemically versatile molecule used as an intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. Its functional groups allow for a variety of reactions, including reduction, coupling, and esterification. This compound is particularly useful in preparing heterocyclic scaffolds and biologically active molecules in medicinal chemistry research.
| CAS Number | 13280-60-9 |
| Synonyms | 3-Carboxy-4-nitroaniline; 2-Nitro-5-aminobenzoic Acid; NSC 74455 |
| Molecular Formula | C7H6N2O4 |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C7H6N2O4/c8-4-1-2-6(9(12)13)5(3-4)7(10)11/h1-3H,8H2,(H,10,11) |
| InChIKey | KZZWQCKYLNIOBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(=O)O)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
