For research use only. Not for therapeutic Use.
5-Amino-2-(hydroxymethyl)phenol is an aromatic compound with an amino group (-NH₂) at the 5-position and a hydroxymethyl group (-CH₂OH) at the 2-position on the phenol ring. The amino group provides basicity, while the hydroxymethyl group enhances solubility and reactivity. This compound is used as an intermediate in organic synthesis, particularly in the preparation of pharmaceuticals, dyes, and other bioactive molecules. Its structure makes it useful in medicinal chemistry, potentially exhibiting antimicrobial, antioxidant, or anticancer properties.
| CAS Number | 40463-78-3 |
| Molecular Formula | C7H9NO2 |
| Purity | ≥95% |
| IUPAC Name | 5-amino-2-(hydroxymethyl)phenol |
| InChI | InChI=1S/C7H9NO2/c8-6-2-1-5(4-9)7(10)3-6/h1-3,9-10H,4,8H2 |
| InChIKey | HDEZKWUFSMWOCB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)O)CO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |