For research use only. Not for therapeutic Use.
(5-Amino-1,3,4-thiadiazol-2-yl)methanol(Cat No.:L019510)is a heterocyclic compound used in pharmaceutical research and organic synthesis. The molecule features a thiadiazole ring with an amino group at the 5-position and a hydroxymethyl group at the 2-position, offering unique reactivity. This compound is valuable as an intermediate in the synthesis of biologically active molecules, including potential drug candidates. The amino and hydroxymethyl functionalities allow for versatile chemical modifications, making it essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced synthetic materials and therapeutic agents.
CAS Number | 56951-58-7 |
Molecular Formula | C3H5N3OS |
Purity | ≥95% |
IUPAC Name | (5-amino-1,3,4-thiadiazol-2-yl)methanol |
InChI | InChI=1S/C3H5N3OS/c4-3-6-5-2(1-7)8-3/h7H,1H2,(H2,4,6) |
InChIKey | URCCVQJLYSKFBQ-UHFFFAOYSA-N |
SMILES | C(C1=NN=C(S1)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |