For research use only. Not for therapeutic Use.
5-(2-Fluorophenyl)-1H-pyrrole-3-carbaldehyde（Cat No.:R073777）is a heteroaromatic compound featuring a pyrrole ring substituted with a 2-fluorophenyl group at the 5-position and an aldehyde group at the 3-position. This light-colored solid serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and functional materials. The fluorinated aryl group enhances metabolic stability and bioavailability in drug development, while the aldehyde moiety allows for further derivatization via condensation or coupling reactions. It should be handled with care under inert, dry conditions to prevent degradation and ensure synthetic efficiency.
| CAS Number | 881674-56-2 |
| Molecular Formula | C11H8FNO |
| Purity | ≥95% |
| IUPAC Name | 5-(2-fluorophenyl)-1H-pyrrole-3-carbaldehyde |
| InChI | InChI=1S/C11H8FNO/c12-10-4-2-1-3-9(10)11-5-8(7-14)6-13-11/h1-7,13H |
| InChIKey | MQULPEUCGKEHEG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CN2)C=O)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
