For research use only. Not for therapeutic Use.
5-{[2-(6-Amino-9H-purin-9-yl)ethyl]amino}-1-pentanol is a bioactive compound featuring a purine base linked to an aminoethyl chain and a pentanol moiety. This structure makes it significant in pharmaceutical research, particularly in the development of nucleoside analogs and potential therapeutic agents targeting various diseases. Its ability to interact with biological targets such as enzymes and receptors enhances its utility in drug discovery. Additionally, it may be investigated for its roles in cellular processes and metabolic pathways.
| CAS Number | 686301-48-4 |
| Synonyms | HTS 09836; |
| Molecular Formula | C12H20N6O |
| Purity | ≥95% |
| Target | Adenylate Cyclase |
| Storage | -20°C |
| IUPAC Name | 5-[2-(6-aminopurin-9-yl)ethylamino]pentan-1-ol |
| InChI | InChI=1S/C12H20N6O/c13-11-10-12(16-8-15-11)18(9-17-10)6-5-14-4-2-1-3-7-19/h8-9,14,19H,1-7H2,(H2,13,15,16) |
| InChIKey | CVPTTZZCRDVGSU-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=N1)N)N=CN2CCNCCCCCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |