For research use only. Not for therapeutic Use.
5′-Deoxy-5-fluoro-N4-(isopentyloxycarbonyl)cytidine(CAT: R009197) is a nucleoside analog designed for antiviral and anticancer research. Structurally derived from cytidine, this compound features a fluorine substitution at the 5-position and a N4-isopentyloxycarbonyl group, enhancing its metabolic stability, membrane permeability, and potentially its bioactivity. It functions as a prodrug or intermediate, capable of undergoing enzymatic conversion into active metabolites that interfere with nucleic acid synthesis or viral replication. This molecule is of particular interest in medicinal chemistry and nucleoside drug development, especially for applications targeting rapidly dividing cells or viral pathogens.
| CAS Number | 162204-30-0 |
| Synonyms | 3-methylbutyl N-[1-[(2R,4R,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
| Molecular Formula | C15H22FN3O6 |
| Purity | ≥95% |
| IUPAC Name | 3-methylbutyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
| InChI | InChI=1S/C15H22FN3O6/c1-7(2)4-5-24-15(23)18-12-9(16)6-19(14(22)17-12)13-11(21)10(20)8(3)25-13/h6-8,10-11,13,20-21H,4-5H2,1-3H3,(H,17,18,22,23)/t8-,10+,11?,13-/m1/s1 |
| InChIKey | PPVCPOIDSSQXMR-FSWKUEMBSA-N |
| SMILES | CC1C(C(C(O1)N2C=C(C(=NC2=O)NC(=O)OCCC(C)C)F)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |