For research use only. Not for therapeutic Use.
4SC-203（Cat No.:I000080）is a small-molecule histone deacetylase (HDAC) inhibitor developed for cancer research and epigenetic modulation. By inhibiting class I and II HDAC enzymes, 4SC-203 promotes acetylation of histone proteins, leading to relaxed chromatin structure and reactivation of tumor suppressor genes. This epigenetic regulation disrupts cancer cell proliferation, induces apoptosis, and affects cell cycle progression. 4SC-203 has shown potential in preclinical studies for treating hematologic malignancies and solid tumors. Its selective HDAC inhibition aims to minimize side effects while enhancing therapeutic efficacy, making it a valuable tool in targeted cancer therapy development.
| CAS Number | 895533-09-2 |
| Synonyms | 1-(2-methoxy-5-methylphenyl)-3-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzothiazol-2-yl]urea |
| Molecular Formula | C33H38N8O4S |
| Purity | ≥95% |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-3-[6-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]amino]-1,3-benzothiazol-2-yl]urea |
| InChI | InChI=1S/C33H38N8O4S/c1-21-6-9-27(43-3)26(16-21)37-32(42)39-33-38-24-8-7-22(17-30(24)46-33)36-31-23-18-28(44-4)29(19-25(23)34-20-35-31)45-15-5-10-41-13-11-40(2)12-14-41/h6-9,16-20H,5,10-15H2,1-4H3,(H,34,35,36)(H2,37,38,39,42) |
| InChIKey | MAFACRSJGNJHCF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)NC(=O)NC2=NC3=C(S2)C=C(C=C3)NC4=NC=NC5=CC(=C(C=C54)OC)OCCCN6CCN(CC6)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
