Home
>
Catalysts and Ligands>Chiral nitrogen ligands> (4S,4'S)-2,2'-(Heptane-4,4-diyl)bis(4-phenyl-4,5-dihydrooxazole)
For research use only. Not for therapeutic Use.
(4S,4’S)-2,2′-(Heptane-4,4-diyl)bis(4-phenyl-4,5-dihydrooxazole)(Cat No.:L002382)is a high-purity chiral compound commonly used in pharmaceutical research and asymmetric synthesis. This bis-oxazoline derivative, featuring a heptane backbone and phenyl groups, is valuable as a ligand in enantioselective catalysis, aiding in the production of optically pure compounds. Its unique structure allows for precise control in asymmetric reactions, making it essential in the development of chiral pharmaceuticals. (4S,4’S)-2,2′-(Heptane-4,4-diyl)bis(4-phenyl-4,5-dihydrooxazole) is crucial for research focused on optimizing synthetic pathways and enhancing stereoselectivity in drug development.
| CAS Number | 1489257-33-1 |
| Molecular Formula | C25H30N2O2 |
| Purity | ≥95% |
| IUPAC Name | (4S)-4-phenyl-2-[4-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]heptan-4-yl]-4,5-dihydro-1,3-oxazole |
| InChI | InChI=1S/C25H30N2O2/c1-3-15-25(16-4-2,23-26-21(17-28-23)19-11-7-5-8-12-19)24-27-22(18-29-24)20-13-9-6-10-14-20/h5-14,21-22H,3-4,15-18H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | NMWFRRYSTLEIHF-FGZHOGPDSA-N |
| SMILES | CCCC(CCC)(C1=NC(CO1)C2=CC=CC=C2)C3=NC(CO3)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |