For research use only. Not for therapeutic Use.
[(4S)-4,5-dihydro-4-(phenylmethyl)-2-oxazolyl]-ferrocene(Cat No.:M132940)is a complex organometallic compound featuring a ferrocene moiety linked to a chiral oxazoline ring substituted with a benzyl group. Its molecular structure C20H20FeN1O1 combines the unique electronic properties of ferrocene with the stereochemical specificity of the oxazoline ring, making it highly useful in asymmetric catalysis and enantioselective synthesis. This compound finds applications in the synthesis of pharmaceuticals and fine chemicals where chiral integrity is crucial. It also serves as a ligand in catalytic systems, enhancing reaction efficiencies and selectivity for producing optically active molecules.
CAS Number | 162157-05-3 |
Synonyms | [(4S)-4,5-dihydro-4-(phenylMethyl)-2-oxazolyl]-Ferrocene |
Molecular Formula | C11H12N4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (4S)-4-benzyl-2-cyclopenta-2,4-dien-1-ylidene-1,3-oxazolidin-3-ide;cyclopenta-1,3-diene;iron(2+) |
InChI | InChI=1S/C15H14NO.C5H5.Fe/c1-2-6-12(7-3-1)10-14-11-17-15(16-14)13-8-4-5-9-13;1-2-4-5-3-1;/h1-9,14H,10-11H2;1-5H;/q2*-1;+2/t14-;;/m0../s1 |
InChIKey | HILZYOWKEFQSPH-UTLKBRERSA-N |
SMILES | C1[C@@H]([N-]C(=C2C=CC=C2)O1)CC3=CC=CC=C3.[CH-]1C=CC=C1.[Fe+2] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |