For research use only. Not for therapeutic Use.
4H-Thieno[3,2-b]pyrrole-5-carboxylic acid(Cat No.:L014158)is a heterocyclic compound featuring a fused thieno-pyrrole core, which serves as a versatile building block in organic synthesis. Its unique structure makes it useful in the development of pharmaceutical compounds and other biologically active molecules. This compound is often employed in the design of new drugs targeting various biochemical pathways due to its ability to modify pharmacokinetic properties. Researchers in medicinal chemistry value 4H-Thieno[3,2-b]pyrrole-5-carboxylic acid for its potential in creating novel therapeutic agents.
CAS Number | 39793-31-2 |
Molecular Formula | C7H5NO2S |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
InChI | InChI=1S/C7H5NO2S/c9-7(10)5-3-6-4(8-5)1-2-11-6/h1-3,8H,(H,9,10) |
InChIKey | PMHDSACGRKBACK-UHFFFAOYSA-N |
SMILES | C1=CSC2=C1NC(=C2)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |