For research use only. Not for therapeutic Use.
4EGI-1(Cat No.:I003126) is a small molecule inhibitor that specifically targets eIF4E/eIF4G interaction, disrupting the eukaryotic translation initiation complex. It inhibits the binding of eIF4E to eIF4G, preventing the assembly of the translation initiation complex and subsequently inhibiting protein synthesis. 4EGI-1 has been shown to selectively inhibit the translation of oncogenic mRNAs, leading to the suppression of tumor growth in various cancer cell lines and xenograft models. Additionally, 4EGI-1 has demonstrated anti-inflammatory effects by inhibiting the synthesis of pro-inflammatory cytokines. It has potential as a therapeutic agent for cancer and inflammatory diseases.
| CAS Number | 315706-13-9 |
| Synonyms | eIF4E/eIF4G Interaction Inhibitor |
| Molecular Formula | C18H12Cl2N4O4S |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | DMSO: ≥ 35 mg/mL |
| Storage | -20°C |
| IC50 | 50μM (72h, for HNE1 cell) |
| IUPAC Name | (2E)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-3-(2-nitrophenyl)propanoic acid |
| InChI | InChI=1S/C18H12Cl2N4O4S/c19-12-6-5-10(7-13(12)20)15-9-29-18(21-15)23-22-14(17(25)26)8-11-3-1-2-4-16(11)24(27)28/h1-7,9H,8H2,(H,21,23)(H,25,26)/b22-14+ |
| InChIKey | KFRKRECSIYXARE-HYARGMPZSA-N |
| SMILES | C1=CC=C(C(=C1)C/C(=N\NC2=NC(=CS2)C3=CC(=C(C=C3)Cl)Cl)/C(=O)O)[N+](=O)[O-] |
| Reference | 1: Wang W, Li J, Wen Q, Luo J, Chu S, Chen L, Qing Z, Xie G, Xu L, Alnemah MM, Li 2: Wang H, Huang F, Wang J, Wang P, Lv W, Hong L, Li S, Zhou J. The synergistic 6: Yefidoff-Freedman R, Chen T, Sahoo R, Chen L, Wagner G, Halperin JA, Aktas BH, |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |