For research use only. Not for therapeutic Use.
4,6-Diphenylpyrimidine is a heterocyclic compound featuring two phenyl groups attached to a pyrimidine ring. Widely used in pharmaceutical and materials science research, this compound serves as a valuable intermediate for synthesizing bioactive molecules and ligands in coordination chemistry. Its planar structure and aromatic rings make it ideal for studying interactions with biological targets, particularly in the development of kinase inhibitors and other therapeutic agents. The compound’s stability and versatility support its applications in drug discovery and advanced material design.
| CAS Number | 3977-48-8 |
| Molecular Formula | C16H12N2 |
| Purity | ≥95% |
| IUPAC Name | 4,6-diphenylpyrimidine |
| InChI | InChI=1S/C16H12N2/c1-3-7-13(8-4-1)15-11-16(18-12-17-15)14-9-5-2-6-10-14/h1-12H |
| InChIKey | BWRMZQGIDWILAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC=N2)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |