For research use only. Not for therapeutic Use.
4,5,6,7-Tetrahydro-2H-isoindole(Cat No.:L036550)is a versatile heterocyclic compound widely used in organic synthesis and pharmaceutical research. Its partially saturated isoindole structure offers unique reactivity, making it a valuable building block for the creation of complex molecules, including potential therapeutic agents. This compound is particularly useful in the development of novel drugs and fine chemicals, where its ring structure can be functionalized in various ways. Its stability and adaptability in chemical reactions make it an essential tool for researchers working on advanced medicinal chemistry and synthetic organic chemistry projects.
CAS Number | 51649-35-5 |
Molecular Formula | C8H11N |
Purity | ≥95% |
IUPAC Name | 4,5,6,7-tetrahydro-2H-isoindole |
InChI | InChI=1S/C8H11N/c1-2-4-8-6-9-5-7(8)3-1/h5-6,9H,1-4H2 |
InChIKey | JSHOAZBZHHEGHI-UHFFFAOYSA-N |
SMILES | C1CCC2=CNC=C2C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |