4,5,6-Trihydroxy-2-oxo-hexanoic acid(Cat No.:M085682) is an organic compound featuring a six-carbon chain, which includes three hydroxyl (OH) groups and a ketone (C=O) group. This structure categorizes it as both a ketonic and a polyhydroxy acid, making it chemically active and reactive. The presence of multiple hydroxyl groups makes it highly hydrophilic (water-loving) and capable of forming hydrogen bonds, which could be useful in various biochemical processes. Such compounds are often of interest in biochemical and pharmaceutical research for their potential roles in metabolic pathways or as building blocks for more complex molecules.
Catalog Number | M085682 |
CAS Number | 17510-99-5 |
Molecular Formula | C6H10O6 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | (4S,5R)-4,5,6-trihydroxy-2-oxohexanoic acid |
InChI | InChI=1S/C6H10O6/c7-2-5(10)3(8)1-4(9)6(11)12/h3,5,7-8,10H,1-2H2,(H,11,12)/t3-,5+/m0/s1 |
InChIKey | WPAMZTWLKIDIOP-WVZVXSGGSA-N |
SMILES | C(C(C(CO)O)O)C(=O)C(=O)O |