For research use only. Not for therapeutic Use.
4′,5′-Dibromofluorescein(Cat No.:R071098)is a halogenated derivative of fluorescein, a widely used fluorophore in scientific research. It contains bromine atoms at the 4′ and 5′ positions of the fluorescein structure, which alters its fluorescence properties, enhancing its brightness and stability. This compound is primarily used in fluorescence microscopy, cell imaging, and assay applications due to its ability to emit strong fluorescence when excited by UV light. 4′,5′-Dibromofluorescein is also employed in studies involving cellular uptake, membrane permeability, and molecular interactions, making it a versatile tool in bioanalytical and diagnostic research.
| CAS Number | 596-03-2 |
| Synonyms | 4′,5′-dibromo-3′,6′-dihydroxyspiro[2-benzofuran-3,9′-xanthene]-1-one |
| Molecular Formula | C20H10Br2O5 |
| Purity | ≥95% |
| IUPAC Name | 4',5'-dibromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChI | InChI=1S/C20H10Br2O5/c21-15-13(23)7-5-11-17(15)26-18-12(6-8-14(24)16(18)22)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H |
| InChIKey | ZDTNHRWWURISAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C(=C(C=C4)O)Br)OC5=C3C=CC(=C5Br)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |