For research use only. Not for therapeutic Use.
4,4,4-Trifluoro-1-(4-nitrophenyl)butane-1,3-dione is a fluorinated diketone featuring trifluoromethyl and nitrophenyl substituents. This compound is significant in organic synthesis and medicinal chemistry due to its potential applications as a building block in the development of pharmaceuticals. The presence of trifluoromethyl groups enhances its lipophilicity and biological activity, while the nitrophenyl group may impart further reactivity. Its unique structure makes it a valuable intermediate for synthesizing compounds with potential antimicrobial, anti-inflammatory, and anticancer properties.
| CAS Number | 35999-53-2 |
| Molecular Formula | C10H6F3NO4 |
| Purity | ≥95% |
| IUPAC Name | 4,4,4-trifluoro-1-(4-nitrophenyl)butane-1,3-dione |
| InChI | InChI=1S/C10H6F3NO4/c11-10(12,13)9(16)5-8(15)6-1-3-7(4-2-6)14(17)18/h1-4H,5H2 |
| InChIKey | CDSAMNVLRSHLPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)C(F)(F)F)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |