1. Home
  2. Product
  3. Materials Science
  4. Material Building Blocks
  5. 4,4',4''-Nitrilotribenzonitrile

4,4',4''-Nitrilotribenzonitrile - CAS 51545-36-9

4,4′,4”-Nitrilotribenzonitrile（Cat No.:L007254）, is a chemical compound used in various industrial applications and research settings. It belongs to the class of aromatic nitriles. This compound has multiple aromatic rings linked by a central nitrogen atom, providing unique reactivity and stability. It is employed in the synthesis of complex organic molecules and as a starting material for the production of dyes, pigments, and specialty chemicals. Its versatile nature makes it valuable in the development of advanced materials, contributing significantly to the fields of organic chemistry and industrial manufacturing processes.

Catalog Number: L007254

CAS Number: 51545-36-9

Molecular Formula: C21H12N4

Molecular Weight:320.30

Purity: ≥95%

Online inquiry

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C21H12N4
Molecular Weight320.30
Purity≥95%

Computed Descriptor

IUPAC Name4-(4-cyano-N-(4-cyanophenyl)anilino)benzonitrile
InChIInChI=1S/C21H12N4/c22-13-16-1-7-19(8-2-16)25(20-9-3-17(14-23)4-10-20)21-11-5-18(15-24)6-12-21/h1-12H
InChIKeyUIPCEBQPPGLTFZ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C#N)N(C2=CC=C(C=C2)C#N)C3=CC=C(C=C3)C#N