For research use only. Not for therapeutic Use.
4,4′-Dipyridylamine(Cat No.:M120304)is an organic compound consisting of two pyridine rings linked by an amine group at the 4-position. This compound is widely used in coordination chemistry, serving as a bidentate ligand that can coordinate with metal ions to form stable complexes. Its ability to bridge metal centers makes it valuable in the design of metal-organic frameworks (MOFs), catalysts, and other advanced materials. Additionally, 4,4′-Dipyridylamine is employed in organic synthesis and research, particularly in the development of novel compounds with potential applications in catalysis and materials science.
CAS Number | 1915-42-0 |
Molecular Formula | C10H9N3 |
Purity | ≥95% |
IUPAC Name | N-pyridin-4-ylpyridin-4-amine |
InChI | InChI=1S/C10H9N3/c1-5-11-6-2-9(1)13-10-3-7-12-8-4-10/h1-8H,(H,11,12,13) |
InChIKey | KDWIKPVYQSPYIX-UHFFFAOYSA-N |
SMILES | C1=CN=CC=C1NC2=CC=NC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |