For research use only. Not for therapeutic Use.
4,4′-Dihydroxy-biphenyl-2-carboxylic acid（Cat No.:L021261）is an aromatic compound featuring a biphenyl core substituted with hydroxyl groups at both 4-positions and a carboxylic acid group at the 2-position. This multifunctional molecule exhibits both phenolic and acidic properties, making it valuable in organic synthesis, polymer chemistry, and pharmaceutical research. The hydroxyl groups enable hydrogen bonding and metal coordination, while the carboxylic acid allows for esterification, amidation, and salt formation. It is often used as a monomer or intermediate in the production of polyesters, polyamides, and biologically active compounds with anti-inflammatory or antimicrobial potential.
| CAS Number | 53197-57-2 |
| Molecular Formula | C13H10O4 |
| Purity | ≥95% |
| IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)benzoic acid |
| InChI | InChI=1S/C13H10O4/c14-9-3-1-8(2-4-9)11-6-5-10(15)7-12(11)13(16)17/h1-7,14-15H,(H,16,17) |
| InChIKey | BBGRLYLKUDNCGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)O)C(=O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
