Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4,4'-(2,2-Diphenylethene-1,1-diyl)dibenzoic acid
For research use only. Not for therapeutic Use.
4,4′-(2,2-Diphenylethene-1,1-diyl)dibenzoic acid (Cat.No:L003818) is a vital compound in materials science. Its unique structure incorporates a diphenylethene motif, conferring specialized properties. This compound is employed as a key building block in the synthesis of advanced materials, particularly in the development of liquid crystal displays and organic electronics. Its versatile reactivity and applications underscore its value in the advancement of innovative technologies and materials for various industries.
| CAS Number | 1609575-40-7 |
| Molecular Formula | C28H20O4 |
| Purity | ≥95% |
| IUPAC Name | 4-[1-(4-carboxyphenyl)-2,2-diphenylethenyl]benzoic acid |
| InChI | InChI=1S/C28H20O4/c29-27(30)23-15-11-21(12-16-23)26(22-13-17-24(18-14-22)28(31)32)25(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-18H,(H,29,30)(H,31,32) |
| InChIKey | WVUPMKOJKIGDAM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)C(=O)O)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |