4,4'-(2-(4-Bromophenyl)-2-phenylethene-1,1-diyl)diphenol - CAS 936803-69-9
4,4′-(2-(4-Bromophenyl)-2-phenylethene-1,1-diyl)diphenol(CAT: L000978) is a significant compound in the realm of material chemistry and organic synthesis. This chemical serves as a key intermediate in the production of advanced materials, particularly in the development of organic electronics and optoelectronic devices. Its unique molecular structure, characterized by a biphenyl framework with a conjugated double bond and bromophenyl substituents, makes it valuable for constructing materials with specific electronic and optical properties.
Catalog Number: L000978
CAS Number: 936803-69-9
Molecular Formula: C26H19BrO2
Molecular Weight:443.3
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
Molecular Formula: | C26H19BrO2 |
---|---|
Molecular Weight | 443.3 |
Purity | ≥95% |
Computed Descriptor
IUPAC Name | 4-[2-(4-bromophenyl)-1-(4-hydroxyphenyl)-2-phenylethenyl]phenol |
---|---|
InChI | InChI=1S/C26H19BrO2/c27-22-12-6-19(7-13-22)25(18-4-2-1-3-5-18)26(20-8-14-23(28)15-9-20)21-10-16-24(29)17-11-21/h1-17,28-29H |
InChIKey | FZKSOPKPNLVTRF-UHFFFAOYSA-N |